C6H7ClN2O — CID 50896588
4-chloro-1,3-dimethylpyrazole-5-carbaldehyde (PubChem CID 50896588) has the molecular formula C6H7ClN2O and a molecular weight of 158.59 g/mol. Its IUPAC name is 4-chloro-1,3-dimethylpyrazole-5-carbaldehyde.
| Compound Name | 4-chloro-1,3-dimethylpyrazole-5-carbaldehyde |
|---|---|
| PubChem CID | 50896588 |
| Molecular Formula | C6H7ClN2O |
| Molecular Weight | 158.59 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | 4-chloro-1,3-dimethylpyrazole-5-carbaldehyde |
| SMILES | Cc1nn(C)c(C=O)c1Cl |
| InChI | InChI=1S/C6H7ClN2O/c1-4-6(7)5(3-10)9(2)8-4/h3H,1-2H3 |
| InChIKey | JVYPCHJPARKYPI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.59 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|