C11H12ClN3O — CID 66408789
1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]pyrrole-3-carbaldehyde (PubChem CID 66408789) has the molecular formula C11H12ClN3O and a molecular weight of 237.69 g/mol. Its IUPAC name is 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]pyrrole-3-carbaldehyde.
| Compound Name | 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 66408789 |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 1-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]pyrrole-3-carbaldehyde |
| SMILES | Cc1nn(C)c(Cn2ccc(C=O)c2)c1Cl |
| InChI | InChI=1S/C11H12ClN3O/c1-8-11(12)10(14(2)13-8)6-15-4-3-9(5-15)7-16/h3-5,7H,6H2,1-2H3 |
| InChIKey | FCAUQXGFXULFPR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|