C13H16BrN3O — CID 66408142
1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]pyrrole-3-carbaldehyde (PubChem CID 66408142) has the molecular formula C13H16BrN3O and a molecular weight of 310.19 g/mol. Its IUPAC name is 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]pyrrole-3-carbaldehyde.
| Compound Name | 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]pyrrole-3-carbaldehyde |
|---|---|
| PubChem CID | 66408142 |
| Molecular Formula | C13H16BrN3O |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 1-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]pyrrole-3-carbaldehyde |
| SMILES | CCc1nn(CC)c(Cn2ccc(C=O)c2)c1Br |
| InChI | InChI=1S/C13H16BrN3O/c1-3-11-13(14)12(17(4-2)15-11)8-16-6-5-10(7-16)9-18/h5-7,9H,3-4,8H2,1-2H3 |
| InChIKey | VLBYAZWHWYDWMY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|