C16H21BrClN3 — CID 107233054
N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-[4-(chloromethyl)phenyl]methanamine (PubChem CID 107233054) has the molecular formula C16H21BrClN3 and a molecular weight of 370.72 g/mol. Its IUPAC name is N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-[4-(chloromethyl)phenyl]methanamine.
| Compound Name | N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-[4-(chloromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 107233054 |
| Molecular Formula | C16H21BrClN3 |
| Molecular Weight | 370.72 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-[4-(chloromethyl)phenyl]methanamine |
| SMILES | CCc1nn(CC)c(CNCc2ccc(CCl)cc2)c1Br |
| InChI | InChI=1S/C16H21BrClN3/c1-3-14-16(17)15(21(4-2)20-14)11-19-10-13-7-5-12(9-18)6-8-13/h5-8,19H,3-4,9-11H2,1-2H3 |
| InChIKey | LTXYBFVCXCKION-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.72 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|