C12H19BrCl2N2 — CID 79448216
4-bromo-5-[3-chloro-2-(chloromethyl)-2-methylpropyl]-1,3-diethylpyrazole (PubChem CID 79448216) has the molecular formula C12H19BrCl2N2 and a molecular weight of 342.11 g/mol. Its IUPAC name is 4-bromo-5-[3-chloro-2-(chloromethyl)-2-methylpropyl]-1,3-diethylpyrazole.
| Compound Name | 4-bromo-5-[3-chloro-2-(chloromethyl)-2-methylpropyl]-1,3-diethylpyrazole |
|---|---|
| PubChem CID | 79448216 |
| Molecular Formula | C12H19BrCl2N2 |
| Molecular Weight | 342.11 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 4-bromo-5-[3-chloro-2-(chloromethyl)-2-methylpropyl]-1,3-diethylpyrazole |
| SMILES | CCc1nn(CC)c(CC(C)(CCl)CCl)c1Br |
| InChI | InChI=1S/C12H19BrCl2N2/c1-4-9-11(13)10(17(5-2)16-9)6-12(3,7-14)8-15/h4-8H2,1-3H3 |
| InChIKey | ZPYVLRWAQNHQIZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.11 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|