C12H20BrClN2 — CID 66033443
4-bromo-5-[2-(chloromethyl)butyl]-1,3-diethylpyrazole (PubChem CID 66033443) has the molecular formula C12H20BrClN2 and a molecular weight of 307.66 g/mol. Its IUPAC name is 4-bromo-5-[2-(chloromethyl)butyl]-1,3-diethylpyrazole.
| Compound Name | 4-bromo-5-[2-(chloromethyl)butyl]-1,3-diethylpyrazole |
|---|---|
| PubChem CID | 66033443 |
| Molecular Formula | C12H20BrClN2 |
| Molecular Weight | 307.66 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 4-bromo-5-[2-(chloromethyl)butyl]-1,3-diethylpyrazole |
| SMILES | CCc1nn(CC)c(CC(CC)CCl)c1Br |
| InChI | InChI=1S/C12H20BrClN2/c1-4-9(8-14)7-11-12(13)10(5-2)15-16(11)6-3/h9H,4-8H2,1-3H3 |
| InChIKey | HBELLGQQYUGETF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|