About 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-(furan-3-yl)propan-2-ol
1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-(furan-3-yl)propan-2-ol (PubChem CID 115467182) has the molecular formula C14H19BrN2O2
and a molecular weight of 327.22 g/mol. Its IUPAC name is 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-(furan-3-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-(furan-3-yl)propan-2-ol |
| PubChem CID | 115467182 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-(furan-3-yl)propan-2-ol |
| SMILES | CCc1nn(CC)c(CC(C)(O)c2ccoc2)c1Br |
| InChI | InChI=1S/C14H19BrN2O2/c1-4-11-13(15)12(17(5-2)16-11)8-14(3,18)10-6-7-19-9-10/h6-7,9,18H,4-5,8H2,1-3H3 |
| InChIKey | BPYXZAZDLIFXSJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-(furan-3-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-(furan-3-yl)propan-2-ol?
The IUPAC name of 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-(furan-3-yl)propan-2-ol (CID 115467182) is 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-(furan-3-yl)propan-2-ol.
What is the SMILES notation for 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-(furan-3-yl)propan-2-ol?
The canonical SMILES for 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-(furan-3-yl)propan-2-ol is CCc1nn(CC)c(CC(C)(O)c2ccoc2)c1Br.
What is the InChIKey of 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-(furan-3-yl)propan-2-ol?
The InChIKey is BPYXZAZDLIFXSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrN2O2/c1-4-11-13(15)12(17(5-2)16-11)8-14(3,18)10-6-7-19-9-10/h6-7,9,18H,4-5,8H2,1-3H3.
What are the key properties of 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-(furan-3-yl)propan-2-ol?
1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-(furan-3-yl)propan-2-ol has a molecular weight of 327.22 g/mol, XLogP of 3.27, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-(furan-3-yl)propan-2-ol is sourced from PubChem (CID 115467182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).