C15H27BrN2O — CID 80558058
1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-methylheptan-2-ol (PubChem CID 80558058) has the molecular formula C15H27BrN2O and a molecular weight of 331.30 g/mol. Its IUPAC name is 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-methylheptan-2-ol.
| Compound Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 80558058 |
| Molecular Formula | C15H27BrN2O |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-2-methylheptan-2-ol |
| SMILES | CCCCCC(C)(O)Cc1c(Br)c(CC)nn1CC |
| InChI | InChI=1S/C15H27BrN2O/c1-5-8-9-10-15(4,19)11-13-14(16)12(6-2)17-18(13)7-3/h19H,5-11H2,1-4H3 |
| InChIKey | FNJNCNLXHYMQRG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|