C16H30BrN3 — CID 105002309
1-(4-bromo-1,3-diethylpyrazol-5-yl)-N-methyloctan-2-amine (PubChem CID 105002309) has the molecular formula C16H30BrN3 and a molecular weight of 344.34 g/mol. Its IUPAC name is 1-(4-bromo-1,3-diethylpyrazol-5-yl)-N-methyloctan-2-amine.
| Compound Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-N-methyloctan-2-amine |
|---|---|
| PubChem CID | 105002309 |
| Molecular Formula | C16H30BrN3 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-N-methyloctan-2-amine |
| SMILES | CCCCCCC(Cc1c(Br)c(CC)nn1CC)NC |
| InChI | InChI=1S/C16H30BrN3/c1-5-8-9-10-11-13(18-4)12-15-16(17)14(6-2)19-20(15)7-3/h13,18H,5-12H2,1-4H3 |
| InChIKey | ALFWAIGKFKQLLD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|