C17H32BrN3 — CID 105002335
1-(4-bromo-1,3-diethylpyrazol-5-yl)-N-ethyloctan-2-amine (PubChem CID 105002335) has the molecular formula C17H32BrN3 and a molecular weight of 358.37 g/mol. Its IUPAC name is 1-(4-bromo-1,3-diethylpyrazol-5-yl)-N-ethyloctan-2-amine.
| Compound Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-N-ethyloctan-2-amine |
|---|---|
| PubChem CID | 105002335 |
| Molecular Formula | C17H32BrN3 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-N-ethyloctan-2-amine |
| SMILES | CCCCCCC(Cc1c(Br)c(CC)nn1CC)NCC |
| InChI | InChI=1S/C17H32BrN3/c1-5-9-10-11-12-14(19-7-3)13-16-17(18)15(6-2)20-21(16)8-4/h14,19H,5-13H2,1-4H3 |
| InChIKey | LQNWIXJKWVUAFW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|