C14H24BrF2N3O — CID 103149167
1-(4-bromo-1,3-diethylpyrazol-5-yl)-4-(2,2-difluoroethoxy)-N-methylbutan-2-amine (PubChem CID 103149167) has the molecular formula C14H24BrF2N3O and a molecular weight of 368.27 g/mol. Its IUPAC name is 1-(4-bromo-1,3-diethylpyrazol-5-yl)-4-(2,2-difluoroethoxy)-N-methylbutan-2-amine.
| Compound Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-4-(2,2-difluoroethoxy)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 103149167 |
| Molecular Formula | C14H24BrF2N3O |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-4-(2,2-difluoroethoxy)-N-methylbutan-2-amine |
| SMILES | CCc1nn(CC)c(CC(CCOCC(F)F)NC)c1Br |
| InChI | InChI=1S/C14H24BrF2N3O/c1-4-11-14(15)12(20(5-2)19-11)8-10(18-3)6-7-21-9-13(16)17/h10,13,18H,4-9H2,1-3H3 |
| InChIKey | NMXYJUPKSSJMPG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|