C12H15ClN4O — CID 82990835
3-amino-1-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]pyridin-4-one (PubChem CID 82990835) has the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. Its IUPAC name is 3-amino-1-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]pyridin-4-one.
| Compound Name | 3-amino-1-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]pyridin-4-one |
|---|---|
| PubChem CID | 82990835 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-amino-1-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]pyridin-4-one |
| SMILES | CCn1nc(C)c(Cl)c1Cn1ccc(=O)c(N)c1 |
| InChI | InChI=1S/C12H15ClN4O/c1-3-17-10(12(13)8(2)15-17)7-16-5-4-11(18)9(14)6-16/h4-6H,3,7,14H2,1-2H3 |
| InChIKey | GVSWZLJEBFGTDJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |