C13H16BrClN4O — CID 104505777
5-amino-3-bromo-1-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-4-methylpyridin-2-one (PubChem CID 104505777) has the molecular formula C13H16BrClN4O and a molecular weight of 359.66 g/mol. Its IUPAC name is 5-amino-3-bromo-1-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-4-methylpyridin-2-one.
| Compound Name | 5-amino-3-bromo-1-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 104505777 |
| Molecular Formula | C13H16BrClN4O |
| Molecular Weight | 359.66 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 5-amino-3-bromo-1-[(4-chloro-1-ethyl-3-methylpyrazol-5-yl)methyl]-4-methylpyridin-2-one |
| SMILES | CCn1nc(C)c(Cl)c1Cn1cc(N)c(C)c(Br)c1=O |
| InChI | InChI=1S/C13H16BrClN4O/c1-4-19-10(12(15)8(3)17-19)6-18-5-9(16)7(2)11(14)13(18)20/h5H,4,6,16H2,1-3H3 |
| InChIKey | XIYMJQUYDBGFPZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.66 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |