About 4-chloro-1,3-dimethylpyrazol-5-olate
4-chloro-1,3-dimethylpyrazol-5-olate (PubChem CID 147232015) has the molecular formula C5H6ClN2O-
and a molecular weight of 145.57 g/mol. Its IUPAC name is 4-chloro-1,3-dimethylpyrazol-5-olate.
Molecular Properties
| Compound Name | 4-chloro-1,3-dimethylpyrazol-5-olate |
| PubChem CID | 147232015 |
| Molecular Formula | C5H6ClN2O- |
| Molecular Weight | 145.57 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | 4-chloro-1,3-dimethylpyrazol-5-olate |
| SMILES | Cc1nn(C)c([O-])c1Cl |
| InChI | InChI=1S/C5H7ClN2O/c1-3-4(6)5(9)8(2)7-3/h9H,1-2H3/p-1 |
| InChIKey | CJCDQMXQAKWCIS-UHFFFAOYSA-M |
| XLogP | 0.46 |
| TPSA | 40.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.57 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-1,3-dimethylpyrazol-5-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,3-dimethylpyrazol-5-olate?
The IUPAC name of 4-chloro-1,3-dimethylpyrazol-5-olate (CID 147232015) is 4-chloro-1,3-dimethylpyrazol-5-olate.
What is the SMILES notation for 4-chloro-1,3-dimethylpyrazol-5-olate?
The canonical SMILES for 4-chloro-1,3-dimethylpyrazol-5-olate is Cc1nn(C)c([O-])c1Cl.
What is the InChIKey of 4-chloro-1,3-dimethylpyrazol-5-olate?
The InChIKey is CJCDQMXQAKWCIS-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H7ClN2O/c1-3-4(6)5(9)8(2)7-3/h9H,1-2H3/p-1.
What are the key properties of 4-chloro-1,3-dimethylpyrazol-5-olate?
4-chloro-1,3-dimethylpyrazol-5-olate has a molecular weight of 145.57 g/mol, XLogP of 0.46, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,3-dimethylpyrazol-5-olate is sourced from PubChem (CID 147232015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).