C6H10ClN3O — CID 79427033
O-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]hydroxylamine (PubChem CID 79427033) has the molecular formula C6H10ClN3O and a molecular weight of 175.62 g/mol. Its IUPAC name is O-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]hydroxylamine.
| Compound Name | O-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 79427033 |
| Molecular Formula | C6H10ClN3O |
| Molecular Weight | 175.62 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | O-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]hydroxylamine |
| SMILES | Cc1nn(C)c(CON)c1Cl |
| InChI | InChI=1S/C6H10ClN3O/c1-4-6(7)5(3-11-8)10(2)9-4/h3,8H2,1-2H3 |
| InChIKey | IWQAMPDHPWNVGW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.62 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|