C14H16ClN3O3 — CID 104784217
(4-chloro-1,3-dimethylpyrazol-5-yl)methyl 4-amino-3-methoxybenzoate (PubChem CID 104784217) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is (4-chloro-1,3-dimethylpyrazol-5-yl)methyl 4-amino-3-methoxybenzoate.
| Compound Name | (4-chloro-1,3-dimethylpyrazol-5-yl)methyl 4-amino-3-methoxybenzoate |
|---|---|
| PubChem CID | 104784217 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | (4-chloro-1,3-dimethylpyrazol-5-yl)methyl 4-amino-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCc2c(Cl)c(C)nn2C)ccc1N |
| InChI | InChI=1S/C14H16ClN3O3/c1-8-13(15)11(18(2)17-8)7-21-14(19)9-4-5-10(16)12(6-9)20-3/h4-6H,7,16H2,1-3H3 |
| InChIKey | TXVYMXYYNYKGJS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|