C13H16ClN3O2S — CID 81207467
2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfinyl]-4-methoxyaniline (PubChem CID 81207467) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfinyl]-4-methoxyaniline.
| Compound Name | 2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfinyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 81207467 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfinyl]-4-methoxyaniline |
| SMILES | COc1ccc(N)c(S(=O)Cc2c(Cl)c(C)nn2C)c1 |
| InChI | InChI=1S/C13H16ClN3O2S/c1-8-13(14)11(17(2)16-8)7-20(18)12-6-9(19-3)4-5-10(12)15/h4-6H,7,15H2,1-3H3 |
| InChIKey | LCHFGPXHIRFSGX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|