C15H19N3O3 — CID 82778841
ethyl 4-amino-3-(1,3,5-trimethylpyrazol-4-yl)oxybenzoate (PubChem CID 82778841) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is ethyl 4-amino-3-(1,3,5-trimethylpyrazol-4-yl)oxybenzoate.
| Compound Name | ethyl 4-amino-3-(1,3,5-trimethylpyrazol-4-yl)oxybenzoate |
|---|---|
| PubChem CID | 82778841 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | ethyl 4-amino-3-(1,3,5-trimethylpyrazol-4-yl)oxybenzoate |
| SMILES | CCOC(=O)c1ccc(N)c(Oc2c(C)nn(C)c2C)c1 |
| InChI | InChI=1S/C15H19N3O3/c1-5-20-15(19)11-6-7-12(16)13(8-11)21-14-9(2)17-18(4)10(14)3/h6-8H,5,16H2,1-4H3 |
| InChIKey | UGJHAVKPJVYNNR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|