C8H15ClN4 — CID 83014675
2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-1,1-dimethylhydrazine (PubChem CID 83014675) has the molecular formula C8H15ClN4 and a molecular weight of 202.69 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83014675 |
| Molecular Formula | C8H15ClN4 |
| Molecular Weight | 202.69 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-1,1-dimethylhydrazine |
| SMILES | Cc1nn(C)c(CNN(C)C)c1Cl |
| InChI | InChI=1S/C8H15ClN4/c1-6-8(9)7(13(4)11-6)5-10-12(2)3/h10H,5H2,1-4H3 |
| InChIKey | FUIFYVWAAFSQHF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.69 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|