C10H17BrClN3 — CID 80667336
2-bromo-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-N-methylpropan-1-amine (PubChem CID 80667336) has the molecular formula C10H17BrClN3 and a molecular weight of 294.62 g/mol. Its IUPAC name is 2-bromo-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-N-methylpropan-1-amine.
| Compound Name | 2-bromo-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 80667336 |
| Molecular Formula | C10H17BrClN3 |
| Molecular Weight | 294.62 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 2-bromo-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-N-methylpropan-1-amine |
| SMILES | Cc1nn(C)c(CN(C)CC(C)Br)c1Cl |
| InChI | InChI=1S/C10H17BrClN3/c1-7(11)5-14(3)6-9-10(12)8(2)13-15(9)4/h7H,5-6H2,1-4H3 |
| InChIKey | PBVXDIKUTDESIY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.62 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|