C11H16ClN5O — CID 114186077
N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2-(5-methyl-1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 114186077) has the molecular formula C11H16ClN5O and a molecular weight of 269.74 g/mol. Its IUPAC name is N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2-(5-methyl-1,2,4-oxadiazol-3-yl)ethanamine.
| Compound Name | N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2-(5-methyl-1,2,4-oxadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 114186077 |
| Molecular Formula | C11H16ClN5O |
| Molecular Weight | 269.74 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2-(5-methyl-1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | Cc1nc(CCNCc2c(Cl)c(C)nn2C)no1 |
| InChI | InChI=1S/C11H16ClN5O/c1-7-11(12)9(17(3)15-7)6-13-5-4-10-14-8(2)18-16-10/h13H,4-6H2,1-3H3 |
| InChIKey | OVXKYFNNUJMKFN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.74 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|