C9H11ClN4OS — CID 104878939
N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(5-methyl-1,2,4-oxadiazol-3-yl)ethanamine (PubChem CID 104878939) has the molecular formula C9H11ClN4OS and a molecular weight of 258.73 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(5-methyl-1,2,4-oxadiazol-3-yl)ethanamine.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(5-methyl-1,2,4-oxadiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 104878939 |
| Molecular Formula | C9H11ClN4OS |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(5-methyl-1,2,4-oxadiazol-3-yl)ethanamine |
| SMILES | Cc1nc(CCNCc2ncc(Cl)s2)no1 |
| InChI | InChI=1S/C9H11ClN4OS/c1-6-13-8(14-15-6)2-3-11-5-9-12-4-7(10)16-9/h4,11H,2-3,5H2,1H3 |
| InChIKey | JCZWSDLPUZCPIL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|