C10H13ClN4S — CID 104879651
N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine (PubChem CID 104879651) has the molecular formula C10H13ClN4S and a molecular weight of 256.76 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 104879651 |
| Molecular Formula | C10H13ClN4S |
| Molecular Weight | 256.76 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine |
| SMILES | Cn1nccc1CCNCc1ncc(Cl)s1 |
| InChI | InChI=1S/C10H13ClN4S/c1-15-8(3-5-14-15)2-4-12-7-10-13-6-9(11)16-10/h3,5-6,12H,2,4,7H2,1H3 |
| InChIKey | SJJVSHSDIUVAMA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.76 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|