C8H10ClN5S — CID 104879611
N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(triazol-1-yl)ethanamine (PubChem CID 104879611) has the molecular formula C8H10ClN5S and a molecular weight of 243.72 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(triazol-1-yl)ethanamine.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(triazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 104879611 |
| Molecular Formula | C8H10ClN5S |
| Molecular Weight | 243.72 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(triazol-1-yl)ethanamine |
| SMILES | Clc1cnc(CNCCn2ccnn2)s1 |
| InChI | InChI=1S/C8H10ClN5S/c9-7-5-11-8(15-7)6-10-1-3-14-4-2-12-13-14/h2,4-5,10H,1,3,6H2 |
| InChIKey | NMNHQWXNLIRJFD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.72 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|