C7H12N8 — CID 107042671
N-[(2-methyltetrazol-5-yl)methyl]-2-(triazol-1-yl)ethanamine (PubChem CID 107042671) has the molecular formula C7H12N8 and a molecular weight of 208.23 g/mol. Its IUPAC name is N-[(2-methyltetrazol-5-yl)methyl]-2-(triazol-1-yl)ethanamine.
| Compound Name | N-[(2-methyltetrazol-5-yl)methyl]-2-(triazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 107042671 |
| Molecular Formula | C7H12N8 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N-[(2-methyltetrazol-5-yl)methyl]-2-(triazol-1-yl)ethanamine |
| SMILES | Cn1nnc(CNCCn2ccnn2)n1 |
| InChI | InChI=1S/C7H12N8/c1-14-11-7(10-13-14)6-8-2-4-15-5-3-9-12-15/h3,5,8H,2,4,6H2,1H3 |
| InChIKey | JVFOGVFXGVGOCM-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 86.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|