C11H15N7O — CID 136824793
N'-hydroxy-4-[[2-(triazol-1-yl)ethylamino]methyl]pyridine-2-carboximidamide (PubChem CID 136824793) has the molecular formula C11H15N7O and a molecular weight of 261.29 g/mol. Its IUPAC name is N'-hydroxy-4-[[2-(triazol-1-yl)ethylamino]methyl]pyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-4-[[2-(triazol-1-yl)ethylamino]methyl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136824793 |
| Molecular Formula | C11H15N7O |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N'-hydroxy-4-[[2-(triazol-1-yl)ethylamino]methyl]pyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1cc(CNCCn2ccnn2)ccn1 |
| InChI | InChI=1S/C11H15N7O/c12-11(16-19)10-7-9(1-2-14-10)8-13-3-5-18-6-4-15-17-18/h1-2,4,6-7,13,19H,3,5,8H2,(H2,12,16) |
| InChIKey | QGZVMFWYFOMCPZ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|