C12H14N4O2 — CID 136960720
4-[(furan-3-ylmethylamino)methyl]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 136960720) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-[(furan-3-ylmethylamino)methyl]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 4-[(furan-3-ylmethylamino)methyl]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136960720 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 4-[(furan-3-ylmethylamino)methyl]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1cc(CNCc2ccoc2)ccn1 |
| InChI | InChI=1S/C12H14N4O2/c13-12(16-17)11-5-9(1-3-15-11)6-14-7-10-2-4-18-8-10/h1-5,8,14,17H,6-7H2,(H2,13,16) |
| InChIKey | FMMTZZWSSAJGPP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|