C12H20N4O2S — CID 136805792
N'-hydroxy-4-[[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]methyl]pyridine-2-carboximidamide (PubChem CID 136805792) has the molecular formula C12H20N4O2S and a molecular weight of 284.39 g/mol. Its IUPAC name is N'-hydroxy-4-[[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]methyl]pyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-4-[[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]methyl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136805792 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N'-hydroxy-4-[[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)amino]methyl]pyridine-2-carboximidamide |
| SMILES | CSCC(C)(O)CNCc1ccnc(/C(N)=N/O)c1 |
| InChI | InChI=1S/C12H20N4O2S/c1-12(17,8-19-2)7-14-6-9-3-4-15-10(5-9)11(13)16-18/h3-5,14,17-18H,6-8H2,1-2H3,(H2,13,16) |
| InChIKey | KYZKLPBMHZWARV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|