C15H24N4OS — CID 136762569
N'-hydroxy-4-[[(1-methylsulfanylcyclohexyl)methylamino]methyl]pyridine-2-carboximidamide (PubChem CID 136762569) has the molecular formula C15H24N4OS and a molecular weight of 308.45 g/mol. Its IUPAC name is N'-hydroxy-4-[[(1-methylsulfanylcyclohexyl)methylamino]methyl]pyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-4-[[(1-methylsulfanylcyclohexyl)methylamino]methyl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136762569 |
| Molecular Formula | C15H24N4OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N'-hydroxy-4-[[(1-methylsulfanylcyclohexyl)methylamino]methyl]pyridine-2-carboximidamide |
| SMILES | CSC1(CNCc2ccnc(/C(N)=N/O)c2)CCCCC1 |
| InChI | InChI=1S/C15H24N4OS/c1-21-15(6-3-2-4-7-15)11-17-10-12-5-8-18-13(9-12)14(16)19-20/h5,8-9,17,20H,2-4,6-7,10-11H2,1H3,(H2,16,19) |
| InChIKey | VSBFNPIHTJOFOC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|