C15H26N4O — CID 136920360
N'-hydroxy-4-[(octylamino)methyl]pyridine-2-carboximidamide (PubChem CID 136920360) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is N'-hydroxy-4-[(octylamino)methyl]pyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-4-[(octylamino)methyl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136920360 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | N'-hydroxy-4-[(octylamino)methyl]pyridine-2-carboximidamide |
| SMILES | CCCCCCCCNCc1ccnc(/C(N)=N/O)c1 |
| InChI | InChI=1S/C15H26N4O/c1-2-3-4-5-6-7-9-17-12-13-8-10-18-14(11-13)15(16)19-20/h8,10-11,17,20H,2-7,9,12H2,1H3,(H2,16,19) |
| InChIKey | BHDCVSJEQLYCOG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|