C14H16N4OS — CID 136759655
N'-hydroxy-4-[(2-methylsulfanylanilino)methyl]pyridine-2-carboximidamide (PubChem CID 136759655) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is N'-hydroxy-4-[(2-methylsulfanylanilino)methyl]pyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-4-[(2-methylsulfanylanilino)methyl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136759655 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | N'-hydroxy-4-[(2-methylsulfanylanilino)methyl]pyridine-2-carboximidamide |
| SMILES | CSc1ccccc1NCc1ccnc(/C(N)=N/O)c1 |
| InChI | InChI=1S/C14H16N4OS/c1-20-13-5-3-2-4-11(13)17-9-10-6-7-16-12(8-10)14(15)18-19/h2-8,17,19H,9H2,1H3,(H2,15,18) |
| InChIKey | KGJGJOHWEFFCPF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|