C12H17N7O — CID 136824794
N'-hydroxy-3-[[3-(triazol-1-yl)propylamino]methyl]pyridine-2-carboximidamide (PubChem CID 136824794) has the molecular formula C12H17N7O and a molecular weight of 275.32 g/mol. Its IUPAC name is N'-hydroxy-3-[[3-(triazol-1-yl)propylamino]methyl]pyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-3-[[3-(triazol-1-yl)propylamino]methyl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136824794 |
| Molecular Formula | C12H17N7O |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N'-hydroxy-3-[[3-(triazol-1-yl)propylamino]methyl]pyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1ncccc1CNCCCn1ccnn1 |
| InChI | InChI=1S/C12H17N7O/c13-12(17-20)11-10(3-1-5-15-11)9-14-4-2-7-19-8-6-16-18-19/h1,3,5-6,8,14,20H,2,4,7,9H2,(H2,13,17) |
| InChIKey | PHMOAOCQGGXAQG-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|