C13H12Br2N4O — CID 136716818
3-[(2,6-dibromoanilino)methyl]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 136716818) has the molecular formula C13H12Br2N4O and a molecular weight of 400.07 g/mol. Its IUPAC name is 3-[(2,6-dibromoanilino)methyl]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 3-[(2,6-dibromoanilino)methyl]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136716818 |
| Molecular Formula | C13H12Br2N4O |
| Molecular Weight | 400.07 g/mol |
| Exact Mass | 397.94 |
| IUPAC Name | 3-[(2,6-dibromoanilino)methyl]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1ncccc1CNc1c(Br)cccc1Br |
| InChI | InChI=1S/C13H12Br2N4O/c14-9-4-1-5-10(15)12(9)18-7-8-3-2-6-17-11(8)13(16)19-20/h1-6,18,20H,7H2,(H2,16,19) |
| InChIKey | AYQAOQDZLYUVHP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.07 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|