C11H14N4O — CID 136954347
3-[(but-2-ynylamino)methyl]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 136954347) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-[(but-2-ynylamino)methyl]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 3-[(but-2-ynylamino)methyl]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136954347 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3-[(but-2-ynylamino)methyl]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | CC#CCNCc1cccnc1/C(N)=N/O |
| InChI | InChI=1S/C11H14N4O/c1-2-3-6-13-8-9-5-4-7-14-10(9)11(12)15-16/h4-5,7,13,16H,6,8H2,1H3,(H2,12,15) |
| InChIKey | JJJOURVAWQJAEY-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|