C13H11BrF2N4O — CID 136852790
3-[(4-bromo-2,5-difluoroanilino)methyl]-N'-hydroxypyridine-2-carboximidamide (PubChem CID 136852790) has the molecular formula C13H11BrF2N4O and a molecular weight of 357.16 g/mol. Its IUPAC name is 3-[(4-bromo-2,5-difluoroanilino)methyl]-N'-hydroxypyridine-2-carboximidamide.
| Compound Name | 3-[(4-bromo-2,5-difluoroanilino)methyl]-N'-hydroxypyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136852790 |
| Molecular Formula | C13H11BrF2N4O |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 3-[(4-bromo-2,5-difluoroanilino)methyl]-N'-hydroxypyridine-2-carboximidamide |
| SMILES | N/C(=N/O)c1ncccc1CNc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C13H11BrF2N4O/c14-8-4-10(16)11(5-9(8)15)19-6-7-2-1-3-18-12(7)13(17)20-21/h1-5,19,21H,6H2,(H2,17,20) |
| InChIKey | QTDBMMIKAROXIU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|