C9H10BrF2N3O — CID 107613140
3-(4-bromo-2,5-difluoroanilino)-N'-hydroxypropanimidamide (PubChem CID 107613140) has the molecular formula C9H10BrF2N3O and a molecular weight of 294.10 g/mol. Its IUPAC name is 3-(4-bromo-2,5-difluoroanilino)-N'-hydroxypropanimidamide.
| Compound Name | 3-(4-bromo-2,5-difluoroanilino)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 107613140 |
| Molecular Formula | C9H10BrF2N3O |
| Molecular Weight | 294.10 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 3-(4-bromo-2,5-difluoroanilino)-N'-hydroxypropanimidamide |
| SMILES | N/C(CCNc1cc(F)c(Br)cc1F)=N/O |
| InChI | InChI=1S/C9H10BrF2N3O/c10-5-3-7(12)8(4-6(5)11)14-2-1-9(13)15-16/h3-4,14,16H,1-2H2,(H2,13,15) |
| InChIKey | CEWLPKSSCQFAPW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.10 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|