C10H14FN3O — CID 77029578
3-(2-fluoro-5-methylanilino)-N'-hydroxypropanimidamide (PubChem CID 77029578) has the molecular formula C10H14FN3O and a molecular weight of 211.24 g/mol. Its IUPAC name is 3-(2-fluoro-5-methylanilino)-N'-hydroxypropanimidamide.
| Compound Name | 3-(2-fluoro-5-methylanilino)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 77029578 |
| Molecular Formula | C10H14FN3O |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 3-(2-fluoro-5-methylanilino)-N'-hydroxypropanimidamide |
| SMILES | Cc1ccc(F)c(NCCC(N)=NO)c1 |
| InChI | InChI=1S/C10H14FN3O/c1-7-2-3-8(11)9(6-7)13-5-4-10(12)14-15/h2-3,6,13,15H,4-5H2,1H3,(H2,12,14) |
| InChIKey | NIVFBHKXKMDMMJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|