C13H20FN — CID 60679773
N-(3,3-dimethylbutyl)-2-fluoro-5-methylaniline (PubChem CID 60679773) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-2-fluoro-5-methylaniline.
| Compound Name | N-(3,3-dimethylbutyl)-2-fluoro-5-methylaniline |
|---|---|
| PubChem CID | 60679773 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | N-(3,3-dimethylbutyl)-2-fluoro-5-methylaniline |
| SMILES | Cc1ccc(F)c(NCCC(C)(C)C)c1 |
| InChI | InChI=1S/C13H20FN/c1-10-5-6-11(14)12(9-10)15-8-7-13(2,3)4/h5-6,9,15H,7-8H2,1-4H3 |
| InChIKey | GWEJDCKRNCRCHX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |