C13H18N4 — CID 113375127
N-[(3,5-dimethylphenyl)methyl]-2-(triazol-1-yl)ethanamine (PubChem CID 113375127) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is N-[(3,5-dimethylphenyl)methyl]-2-(triazol-1-yl)ethanamine.
| Compound Name | N-[(3,5-dimethylphenyl)methyl]-2-(triazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 113375127 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N-[(3,5-dimethylphenyl)methyl]-2-(triazol-1-yl)ethanamine |
| SMILES | Cc1cc(C)cc(CNCCn2ccnn2)c1 |
| InChI | InChI=1S/C13H18N4/c1-11-7-12(2)9-13(8-11)10-14-3-5-17-6-4-15-16-17/h4,6-9,14H,3,5,10H2,1-2H3 |
| InChIKey | LAEDPHVYQFYIPZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|