C12H12FN5 — CID 107904778
4-fluoro-2-[[2-(triazol-1-yl)ethylamino]methyl]benzonitrile (PubChem CID 107904778) has the molecular formula C12H12FN5 and a molecular weight of 245.26 g/mol. Its IUPAC name is 4-fluoro-2-[[2-(triazol-1-yl)ethylamino]methyl]benzonitrile.
| Compound Name | 4-fluoro-2-[[2-(triazol-1-yl)ethylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 107904778 |
| Molecular Formula | C12H12FN5 |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 4-fluoro-2-[[2-(triazol-1-yl)ethylamino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(F)cc1CNCCn1ccnn1 |
| InChI | InChI=1S/C12H12FN5/c13-12-2-1-10(8-14)11(7-12)9-15-3-5-18-6-4-16-17-18/h1-2,4,6-7,15H,3,5,9H2 |
| InChIKey | AGRSKKFZSJTESW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|