C10H14N6 — CID 106937288
N-[(1-ethenylpyrazol-4-yl)methyl]-2-(triazol-1-yl)ethanamine (PubChem CID 106937288) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is N-[(1-ethenylpyrazol-4-yl)methyl]-2-(triazol-1-yl)ethanamine.
| Compound Name | N-[(1-ethenylpyrazol-4-yl)methyl]-2-(triazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 106937288 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | N-[(1-ethenylpyrazol-4-yl)methyl]-2-(triazol-1-yl)ethanamine |
| SMILES | C=Cn1cc(CNCCn2ccnn2)cn1 |
| InChI | InChI=1S/C10H14N6/c1-2-15-9-10(8-13-15)7-11-3-5-16-6-4-12-14-16/h2,4,6,8-9,11H,1,3,5,7H2 |
| InChIKey | PIPYTOZBHFVNQW-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|