C7H7ClN2S — CID 104878439
N-[(5-chloro-1,3-thiazol-2-yl)methyl]prop-2-yn-1-amine (PubChem CID 104878439) has the molecular formula C7H7ClN2S and a molecular weight of 186.67 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]prop-2-yn-1-amine.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 104878439 |
| Molecular Formula | C7H7ClN2S |
| Molecular Weight | 186.67 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]prop-2-yn-1-amine |
| SMILES | C#CCNCc1ncc(Cl)s1 |
| InChI | InChI=1S/C7H7ClN2S/c1-2-3-9-5-7-10-4-6(8)11-7/h1,4,9H,3,5H2 |
| InChIKey | SYQWNRCVFXQZBT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.67 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|