C7H11ClN2S — CID 66223891
N-[(5-chloro-1,3-thiazol-2-yl)methyl]propan-2-amine (PubChem CID 66223891) has the molecular formula C7H11ClN2S and a molecular weight of 190.70 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]propan-2-amine.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 66223891 |
| Molecular Formula | C7H11ClN2S |
| Molecular Weight | 190.70 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]propan-2-amine |
| SMILES | CC(C)NCc1ncc(Cl)s1 |
| InChI | InChI=1S/C7H11ClN2S/c1-5(2)9-4-7-10-3-6(8)11-7/h3,5,9H,4H2,1-2H3 |
| InChIKey | VPFDAFBXCTXETL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.70 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |