C8H7ClN4S — CID 130736430
N-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrimidin-2-amine (PubChem CID 130736430) has the molecular formula C8H7ClN4S and a molecular weight of 226.69 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrimidin-2-amine.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 130736430 |
| Molecular Formula | C8H7ClN4S |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]pyrimidin-2-amine |
| SMILES | Clc1cnc(CNc2ncccn2)s1 |
| InChI | InChI=1S/C8H7ClN4S/c9-6-4-12-7(14-6)5-13-8-10-2-1-3-11-8/h1-4H,5H2,(H,10,11,13) |
| InChIKey | VWTSJIPJKZXYGZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |