C13H10ClN3S — CID 104878700
N-[(5-chloro-1,3-thiazol-2-yl)methyl]quinolin-8-amine (PubChem CID 104878700) has the molecular formula C13H10ClN3S and a molecular weight of 275.76 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]quinolin-8-amine.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]quinolin-8-amine |
|---|---|
| PubChem CID | 104878700 |
| Molecular Formula | C13H10ClN3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]quinolin-8-amine |
| SMILES | Clc1cnc(CNc2cccc3cccnc23)s1 |
| InChI | InChI=1S/C13H10ClN3S/c14-11-7-17-12(18-11)8-16-10-5-1-3-9-4-2-6-15-13(9)10/h1-7,16H,8H2 |
| InChIKey | PZUBOQCWIZQORC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |