C16H13ClN2S — CID 104921590
N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-phenylaniline (PubChem CID 104921590) has the molecular formula C16H13ClN2S and a molecular weight of 300.81 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-phenylaniline.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-phenylaniline |
|---|---|
| PubChem CID | 104921590 |
| Molecular Formula | C16H13ClN2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-phenylaniline |
| SMILES | Clc1cnc(CNc2ccccc2-c2ccccc2)s1 |
| InChI | InChI=1S/C16H13ClN2S/c17-15-10-19-16(20-15)11-18-14-9-5-4-8-13(14)12-6-2-1-3-7-12/h1-10,18H,11H2 |
| InChIKey | RAANBDHWXVUIPO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |