C10H7ClF2N2S — CID 104921572
N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline (PubChem CID 104921572) has the molecular formula C10H7ClF2N2S and a molecular weight of 260.70 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 104921572 |
| Molecular Formula | C10H7ClF2N2S |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2,4-difluoroaniline |
| SMILES | Fc1ccc(NCc2ncc(Cl)s2)c(F)c1 |
| InChI | InChI=1S/C10H7ClF2N2S/c11-9-4-15-10(16-9)5-14-8-2-1-6(12)3-7(8)13/h1-4,14H,5H2 |
| InChIKey | CLNJBNGJGFRZSF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |