C13H14ClN3O2S — CID 104879474
3-[2-[(5-chloro-1,3-thiazol-2-yl)methylamino]phenoxy]propanamide (PubChem CID 104879474) has the molecular formula C13H14ClN3O2S and a molecular weight of 311.79 g/mol. Its IUPAC name is 3-[2-[(5-chloro-1,3-thiazol-2-yl)methylamino]phenoxy]propanamide.
| Compound Name | 3-[2-[(5-chloro-1,3-thiazol-2-yl)methylamino]phenoxy]propanamide |
|---|---|
| PubChem CID | 104879474 |
| Molecular Formula | C13H14ClN3O2S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 3-[2-[(5-chloro-1,3-thiazol-2-yl)methylamino]phenoxy]propanamide |
| SMILES | NC(=O)CCOc1ccccc1NCc1ncc(Cl)s1 |
| InChI | InChI=1S/C13H14ClN3O2S/c14-11-7-17-13(20-11)8-16-9-3-1-2-4-10(9)19-6-5-12(15)18/h1-4,7,16H,5-6,8H2,(H2,15,18) |
| InChIKey | ZNVNHGHJMVAIIK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |