C13H17N5O2 — CID 115744008
3-[2-[(3-methyltriazol-4-yl)methylamino]phenoxy]propanamide (PubChem CID 115744008) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-[2-[(3-methyltriazol-4-yl)methylamino]phenoxy]propanamide.
| Compound Name | 3-[2-[(3-methyltriazol-4-yl)methylamino]phenoxy]propanamide |
|---|---|
| PubChem CID | 115744008 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 3-[2-[(3-methyltriazol-4-yl)methylamino]phenoxy]propanamide |
| SMILES | Cn1nncc1CNc1ccccc1OCCC(N)=O |
| InChI | InChI=1S/C13H17N5O2/c1-18-10(9-16-17-18)8-15-11-4-2-3-5-12(11)20-7-6-13(14)19/h2-5,9,15H,6-8H2,1H3,(H2,14,19) |
| InChIKey | GOEUXYDLNLTOAT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |