C9H12ClN5S — CID 107124058
N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine (PubChem CID 107124058) has the molecular formula C9H12ClN5S and a molecular weight of 257.75 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 107124058 |
| Molecular Formula | C9H12ClN5S |
| Molecular Weight | 257.75 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine |
| SMILES | Cn1cnnc1CCNCc1ncc(Cl)s1 |
| InChI | InChI=1S/C9H12ClN5S/c1-15-6-13-14-8(15)2-3-11-5-9-12-4-7(10)16-9/h4,6,11H,2-3,5H2,1H3 |
| InChIKey | WZGHASAIJIIENM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.75 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|